On Target RT_HIV1 0.22222222/CHEMBL4225614
For the given ligand XRK3F2, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL4225614. Check out the elaboration below.
| XRK3F2 (Given Ligand) | CHEMBL4225614 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCOCC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000000 01000c00 00100302 c0050600 00000080 00004000 80000080 20000402 00000900 001809e0 08300000 40018800 00028002 00200000 0008140a 00080108 10000400 02000020 02012000 00000201 01000100 18020a30 12008020 00500014 01200400 80000000 00406000 d0000001 00400202 01060012 e4020000 00002600 |