On Target NS3_HCV1A 0.38356164/CHEMBL3951374
For the given ligand XIE106, we have found in our database that, being scored 0.38356164, the most similar ligand is CHEMBL3951374. Check out the elaboration below.
| XIE106 (Given Ligand) | CHEMBL3951374 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc([C@H](N[C@@H](C)CC(N)=O)C2CC2)c(F)c1C(=O)c1ccc(F)cc1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 000000c0 01000c08 2010010a 02010600 00001201 00020010 12040000 23001200 00000800 00088fc0 08300000 40009200 0c008842 01201000 01200401 08082008 03000200 02000080 00000410 00120201 00000102 18028600 01000000 32400014 00001000 e0000000 08320800 d0800001 00000380 00068012 a2040010 00002600 |