On Target NP_HCoV-OC43 0.08943089/CHEMBL3233481
For the given ligand XIE2008, we have found in our database that, being scored 0.08943089, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |