On Target NS5B_HCV1A 0.26086956/CHEMBL363650
For the given ligand XIE5-2-35, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| XIE5-2-35 (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 04008002 44000008 20004108 10210e00 00041020 00104000 02040000 02003001 00000100 00000840 00210004 40008800 02804886 00010080 01020401 020c810c 00002000 02000002 00680000 00020200 40000000 08008120 20800000 00c49000 00102000 c0002000 00260040 80000000 00000304 00060008 40040000 00024200 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |