On Target PR_HIV1 0.24855492/CHEMBL510485
For the given ligand XIE2008, we have found in our database that, being scored 0.24855492, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |