On Target NS3_HCV1B 0.19202898/CHEMBL297884
For the given ligand XIE2008, we have found in our database that, being scored 0.19202898, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |