On Target ACE2_HUMAN 0.41428572/CHEMBL254911
For the given ligand XIE5-2-17, we have found in our database that, being scored 0.41428572, the most similar ligand is CHEMBL254911. Check out the elaboration below.
| XIE5-2-17 (Given Ligand) | CHEMBL254911 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCCCN1CCOCC1)cc2OCc3ccc(F)cc3)cc4 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccc(F)cc2)cc1)C(=O)O |
|
|
|
|
|
|
| 04000000 44000408 20100108 82210600 00001080 00004010 02040000 02001000 00000100 00000960 00200000 40008000 00804802 00011080 01081409 02088108 10000000 02000200 00480000 00120200 00000000 18008020 12000000 00c49010 00000400 c0002000 00220000 80000001 00000300 00068018 60040000 00000200 | 04010000 01005008 20100108 02110600 00001080 00004010 82040000 20000004 00000980 020a08c0 08300000 4001b000 06808002 00051000 81080001 02080008 10000000 02000200 00400008 00120201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 10000041 04000200 00068003 60004000 03012600 |