On Target NS5B_HCV1B 0.30569947/CHEMBL3645183
For the given ligand PY1-61, we have found in our database that, being scored 0.30569947, the most similar ligand is CHEMBL3645183. Check out the elaboration below.
| PY1-61 (Given Ligand) | CHEMBL3645183 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(C(NC(=O)Cc1ccccc1)NC(=O)Cc2ccccc2)cc3 | CCN(c1cc2nn(-c3ccc(NCC(C)C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00004002 01800800 00100100 80010e00 00000000 00000000 00000004 02003000 00000080 00080840 08200004 40009000 01009802 00008000 40000440 00000000 00040008 02000000 08000040 00000201 c0100100 18218600 20000000 81400018 00010000 c0000000 00000000 80000080 04008100 00060203 20042000 00000600 | 00004006 00805e08 20180902 41390e00 210c0000 00004042 02040000 0200140c 00100900 000908c0 09312024 40118800 80008c23 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048080 a01147e0 |