On Target NS5B_HCV1A 0.3122172/CHEMBL176058
For the given ligand PY2-64, we have found in our database that, being scored 0.3122172, the most similar ligand is CHEMBL176058. Check out the elaboration below.
| PY2-64 (Given Ligand) | CHEMBL176058 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2ccccc21 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 10204012 0082d01a 21004102 04b11690 00441002 00000060 06084100 0a001400 06000310 c000c8f3 07202204 6001c000 21009806 02680001 80320044 040c200c 04040110 c2302004 08200000 0006200d c0120000 18018818 20812002 88720018 00044008 c0403000 48800080 940e00c8 00c48118 200600c1 e41ca018 84211a20 |