On Target PLP_SARS 0.2736842/CHEMBL358279
For the given ligand MLN-4760-ACE2, we have found in our database that, being scored 0.2736842, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| MLN-4760-ACE2 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CC(C)CC(NC(Cc1cncn1Cc2cc(Cl)cc(Cl)c2)C(=O)O)C(=O)O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 04018002 09800200 00101100 01810610 040800c0 00000020 04002000 20001000 80400980 10090ac0 2020a008 5001b800 06009806 00100c02 812b0080 000c000c 10000000 0e000000 00480018 40010201 80000c00 18208b00 230000c1 93400410 00043001 c0000200 10000000 10000000 04400004 00460008 400c4004 20022600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |