On Target NP_HCoV-OC43 0.092391305/CHEMBL3233481
For the given ligand AMP-NSP3, we have found in our database that, being scored 0.092391305, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| AMP-NSP3 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000000a 01c01800 80080510 89090e20 003800e4 0000c000 0000cc00 00000800 00404100 018000b0 0c00800c 40019004 00001000 038a0120 00081080 101eca0c 002a0020 00000000 19c00000 80205003 80080020 14000850 27800040 0c000014 10000400 40000002 0e000200 10010070 00000208 00460014 c1680000 000080c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |