On Target RDRP_SARS2 0.32550335/CHEMBL4065616
For the given ligand AMP-NSP3, we have found in our database that, being scored 0.32550335, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| AMP-NSP3 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 0000000a 01c01800 80080510 89090e20 003800e4 0000c000 0000cc00 00000800 00404100 018000b0 0c00800c 40019004 00001000 038a0120 00081080 101eca0c 002a0020 00000000 19c00000 80205003 80080020 14000850 27800040 0c000014 10000400 40000002 0e000200 10010070 00000208 00460014 c1680000 000080c0 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |