On Target PA_INFA 0.30994153/CHEMBL463590
For the given ligand MLN-4760-ACE2, we have found in our database that, being scored 0.30994153, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| MLN-4760-ACE2 (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| CC(C)CC(NC(Cc1cncn1Cc2cc(Cl)cc(Cl)c2)C(=O)O)C(=O)O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 04018002 09800200 00101100 01810610 040800c0 00000020 04002000 20001000 80400980 10090ac0 2020a008 5001b800 06009806 00100c02 812b0080 000c000c 10000000 0e000000 00480018 40010201 80000c00 18208b00 230000c1 93400410 00043001 c0000200 10000000 10000000 04400004 00460008 400c4004 20022600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |