On Target PA_INFA 0.22900763/CHEMBL2443239
For the given ligand SCHEMBL17719237-RDRP, we have found in our database that, being scored 0.22900763, the most similar ligand is CHEMBL2443239. Check out the elaboration below.
| SCHEMBL17719237-RDRP (Given Ligand) | CHEMBL2443239 (Similar Ligand) |
|---|---|
| N#CC3(c1ccc2c(N)ncnn12)OC(COP(=O)(O)O)C(O)C3O | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(-c3nnn[nH]3)cc2)cc1O |
|
|
|
|
|
|
| 0000000a 81004009 e2103512 19010f20 052c80f4 8000c004 0301c000 00200a00 10404b00 010c0040 08188004 42839040 00001802 02b30020 000e0040 020eaa0c 084b8820 06800004 01602008 00665203 40120120 3c008860 a5801cc6 08700110 00000400 80002000 0e0880c0 900108a0 0040020e 00c6cc16 41400280 22208c80 | 00002002 40000019 60104100 12010210 01841028 0400005c 00800800 00280000 06000100 50000860 04008084 40008000 00018894 00201001 20120000 820c200c 00020060 02002804 04200000 10721002 40060120 88008000 3080c000 00504400 00042403 c0280000 18020240 00000041 00404004 00028400 80000a00 08000200 |