On Target NS3_HCV1B 0.24523161/CHEMBL297884
For the given ligand SCHEMBL17719237-RDRP, we have found in our database that, being scored 0.24523161, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| SCHEMBL17719237-RDRP (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| N#CC3(c1ccc2c(N)ncnn12)OC(COP(=O)(O)O)C(O)C3O | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 0000000a 81004009 e2103512 19010f20 052c80f4 8000c004 0301c000 00200a00 10404b00 010c0040 08188004 42839040 00001802 02b30020 000e0040 020eaa0c 084b8820 06800004 01602008 00665203 40120120 3c008860 a5801cc6 08700110 00000400 80002000 0e0880c0 900108a0 0040020e 00c6cc16 41400280 22208c80 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |