On Target ACE2_HUMAN 0.19469027/CHEMBL429844
For the given ligand AMP-NSP3, we have found in our database that, being scored 0.19469027, the most similar ligand is CHEMBL429844. Check out the elaboration below.
| AMP-NSP3 (Given Ligand) | CHEMBL429844 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O | CC(C)C[C@H](N[C@@H](Cc1cncn1Cc1cc(Cl)cc(Cl)c1)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 0000000a 01c01800 80080510 89090e20 003800e4 0000c000 0000cc00 00000800 00404100 018000b0 0c00800c 40019004 00001000 038a0120 00081080 101eca0c 002a0020 00000000 19c00000 80205003 80080020 14000850 27800040 0c000014 10000400 40000002 0e000200 10010070 00000208 00460014 c1680000 000080c0 | 04018002 09800200 00101100 01810610 040800c0 00000020 04002000 20001000 80400980 10090ac0 2020a008 5001b800 06009806 00100c02 812b0080 000c000c 10000000 0e000000 00480018 40010201 80000c00 18208b00 230000c1 93400410 00043001 c0000200 10000000 10000000 04400004 00460008 400c4004 20022600 |