On Target NS3_HCV1A 0.615/CHEMBL3696817
For the given ligand AMP-NSP3, we have found in our database that, being scored 0.615, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| AMP-NSP3 (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 0000000a 01c01800 80080510 89090e20 003800e4 0000c000 0000cc00 00000800 00404100 018000b0 0c00800c 40019004 00001000 038a0120 00081080 101eca0c 002a0020 00000000 19c00000 80205003 80080020 14000850 27800040 0c000014 10000400 40000002 0e000200 10010070 00000208 00460014 c1680000 000080c0 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |