On Target PLP_SARS 0.21/CHEMBL222893
For the given ligand Tideglusib, we have found in our database that, being scored 0.21, the most similar ligand is CHEMBL222893. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL222893 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1 |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 04018042 15000808 60004108 20010200 000c1040 04004084 80080080 01200000 00000100 00000840 00000204 40058880 0680881c 08010002 01032082 060c000c 09030000 02002008 00200008 00020010 40002060 48028ba8 30900080 10c09004 02002c02 84082200 00000200 80000004 00000200 00020000 c0000000 10c30400 |