On Target NS5B_HCV1A 0.24223602/CHEMBL363650
For the given ligand Ebselen, we have found in our database that, being scored 0.24223602, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |