On Target RT_HIV1 0.24603175/CHEMBL4108806
For the given ligand Ebselen, we have found in our database that, being scored 0.24603175, the most similar ligand is CHEMBL4108806. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL4108806 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(CC2CC(F)(F)C2)S(=O)(=O)c2ccc3cc[nH]c(=O)c3c2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 00010012 09803200 03184100 05b10601 100c00c0 00038060 04000081 2300500e 06c60b00 404918e0 0d302204 e001b880 8c008812 00602031 807c2440 001e020c 18423000 0219000c 00f00018 00006e0d c0001900 78288e98 23900000 db500058 42080800 e4010106 40000820 d000202c 0c200780 2406000f a0044000 00c107f0 |