On Target PR_HIV1 0.17307693/CHEMBL494500
For the given ligand Ebselen, we have found in our database that, being scored 0.17307693, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |