On Target PA_INFA 0.2356688/CHEMBL278402
For the given ligand Ebselen, we have found in our database that, being scored 0.2356688, the most similar ligand is CHEMBL278402. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL278402 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | O=C(O)C(=O)/C=C(\O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 00030e00 |