On Target NS3_HCV1B 0.19465649/CHEMBL1170417
For the given ligand Ebselen, we have found in our database that, being scored 0.19465649, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |