On Target ACE2_HUMAN 0.2184466/CHEMBL429844
For the given ligand Tideglusib, we have found in our database that, being scored 0.2184466, the most similar ligand is CHEMBL429844. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL429844 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | CC(C)C[C@H](N[C@@H](Cc1cncn1Cc1cc(Cl)cc(Cl)c1)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 04018002 09800200 00101100 01810610 040800c0 00000020 04002000 20001000 80400980 10090ac0 2020a008 5001b800 06009806 00100c02 812b0080 000c000c 10000000 0e000000 00480018 40010201 80000c00 18208b00 230000c1 93400410 00043001 c0000200 10000000 10000000 04400004 00460008 400c4004 20022600 |