On Target NSP1_SARS 0.23780487/CHEMBL2441741
For the given ligand ggggg, we have found in our database that, being scored 0.23780487, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| ggggg (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00040000 42000008 20000500 00010200 00000041 40000000 82000080 00000440 01800800 00080840 48100000 4010d080 0c008002 00000000 00040002 00088008 08020400 82000000 24418018 00020201 00010120 08000a00 05000041 08400014 00001c00 80000000 00522000 40000420 00400200 00020102 04000000 02000410 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |