On Target NS5B_HCV1A 0.2576687/CHEMBL348944
For the given ligand 1, we have found in our database that, being scored 0.2576687, the most similar ligand is CHEMBL348944. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL348944 (Similar Ligand) |
|---|---|
| CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 | CCC(C)[C@H](NC(=O)OCc1ccc(C(=O)O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00050040 01000800 00000508 00810300 803c0050 00204000 00002800 08000040 00202100 01000860 00040000 40009000 14008028 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a20 05000000 08400014 00000400 80002000 00088000 24000020 00000200 0002000a c0a20000 02000000 | 01010000 01403800 00100100 44050600 00081000 0001c000 00000000 20000008 04800300 000008c0 00200000 4001f000 0e008002 00012001 80000000 021a0408 000a0000 02080401 00c00890 00000201 00000000 38160e70 01000083 0250001c 00001001 80002082 00000060 90200020 08000200 02060001 e0004000 00002200 |