On Target PA_INFA 0.20930232/CHEMBL1829211
For the given ligand 1, we have found in our database that, being scored 0.20930232, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00050040 01000800 00000508 00810300 803c0050 00204000 00002800 08000040 00202100 01000860 00040000 40009000 14008028 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a20 05000000 08400014 00000400 80002000 00088000 24000020 00000200 0002000a c0a20000 02000000 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |