On Target PR_HIV1 0.1618497/CHEMBL510485
For the given ligand Ferulic acid, we have found in our database that, being scored 0.1618497, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Ferulic acid (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| COc1cc(/C=C/C(=O)O)ccc1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00000000 40000008 20000108 00010200 00001000 00000000 82000080 00000400 01800000 00000840 00000000 40108000 0400c002 00000000 01000003 00088008 00000400 02000000 00098018 00020200 00000000 08000a00 00000001 00400000 00001000 80000000 00422000 40000000 00400200 00020100 04000000 00000100 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |