On Target ACE2_HUMAN 0.21596244/CHEMBL254495
For the given ligand Galuteolin, we have found in our database that, being scored 0.21596244, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| Galuteolin (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 04402041 41200018 28080108 00110300 80281240 82004820 42002800 40800200 02284100 41000860 40000010 41008000 40808412 02a00088 11200021 002ab208 00864040 02000840 1f48a200 00821a01 00340020 08000828 15200000 0a580010 08000400 80000000 040200b5 2c900060 51056200 01820800 40a00040 00010000 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |