On Target NSP1_SARS 0.21666667/CHEMBL471187
For the given ligand protocatechuic acid, we have found in our database that, being scored 0.21666667, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| protocatechuic acid (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| O=C(O)c1ccc(O)c(O)c1 | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00000000 48000808 20000101 00010200 00000000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00008002 00000000 00000000 20088008 00000000 02000000 00000000 00020200 00000000 08020a20 00000000 00400004 00000000 80000000 00420000 00000000 00000000 00020000 c0000000 00000000 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |