On Target NS5B_HCV1B 0.26265824/CHEMBL3970609
For the given ligand Hyperoside, we have found in our database that, being scored 0.26265824, the most similar ligand is CHEMBL3970609. Check out the elaboration below.
| Hyperoside (Given Ligand) | CHEMBL3970609 (Similar Ligand) |
|---|---|
| O=c3c(OC1OC(CO)C(O)C(O)C1O)c(c2ccc(O)c(O)c2)oc4cc(O)cc(O)c34 | CO[C@]1(c2ccc3c(N)ncnn23)O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@]1(C)C#N |
|
|
|
|
|
|
| 0c402001 41200018 20080108 01110300 803d124c 82004820 03042800 40802200 022a4110 41000860 40000090 41008010 40808412 02a00088 11200021 002ab208 00864040 22008840 1f48a200 00825a03 00340020 08000c28 15000000 0a584010 08400400 80000000 140a00b4 2c900068 01006300 11820a01 41e00240 02b50008 | 0000080a 81004009 e2401512 19010f20 052c8074 0012c024 0381e800 00200a80 1060cb00 010c0060 08108004 4a839040 00000802 02b30020 000e0040 022cba0c 09cb8820 0680000e 1160a008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 160880c0 a40508a0 0040020e 00c6cc16 41600280 6220ac82 |