On Target GP_EBOV 0.16666667/CHEMBL112570
For the given ligand curcumin, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| curcumin (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |