On Target PLP_SARS 0.34334764/CHEMBL213054
For the given ligand LIGAND_65, we have found in our database that, being scored 0.34334764, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |