On Target NS5B_HCV1A 0.24852072/CHEMBL446360
For the given ligand LIGAND 70, we have found in our database that, being scored 0.24852072, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| LIGAND 70 (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| O=C(O)c6cc(C(c4cc(Cc3cc(C(c1ccc(O)c(C(=O)O)c1)c2ccc(O)c(C(=O)O)c2)cc(C(=O)O)c3O)cc(C(=O)O)c4O)=c5ccc(=O)c(C(=O)O)c5)ccc6O | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000002 80040808 20000100 00090280 40200001 00024001 82200280 03000e02 01000100 00180a40 28000000 40009200 14028002 20020000 00000002 0808600c 00000400 02000000 10490090 42022001 00002011 08020aa0 01408001 00400816 00201000 a0000400 00522008 c0800000 00404080 88220002 c6000000 01000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |