On Target NS5B_HCV1A 0.25606468/CHEMBL3644940
For the given ligand LIGAND 40, we have found in our database that, being scored 0.25606468, the most similar ligand is CHEMBL3644940. Check out the elaboration below.
| LIGAND 40 (Given Ligand) | CHEMBL3644940 (Similar Ligand) |
|---|---|
| C#CC4C16OPO/C=C1/OC5(n3cnc2c(=O)[nH]c(N)nc23)OC456 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2cc(Nc3ccccc3)nc(OC)n2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0080000a 81c41800 80081e00 81010f00 807829e4 0008c140 0082fc84 88083c00 16604100 81f000fa 8c00808c 4001d000 80009000 23c80100 02081484 113ed00c 01ab202c 00008000 39c1c010 0020d403 c0180128 1c000ed0 27800ac0 0c706814 10028405 c0200016 7e200202 b4050078 0003c218 00465020 d5e80800 8001c280 | 00030486 0d403410 00100120 0d390f00 a0080000 0001c100 000a8814 a0103c09 10802300 00528be8 00302424 7001b050 0e00f102 01042101 a0c20640 001e800c 12865010 10486000 4861085a 10205a01 60120300 be050e10 21824043 3204003a 02192000 00f01102 02000400 902000ac 0a008218 81460093 e4185000 050122f0 |