On Target RT_HIV1 0.23453608/CHEMBL4108778
For the given ligand LIGAND 40, we have found in our database that, being scored 0.23453608, the most similar ligand is CHEMBL4108778. Check out the elaboration below.
| LIGAND 40 (Given Ligand) | CHEMBL4108778 (Similar Ligand) |
|---|---|
| C#CC4C16OPO/C=C1/OC5(n3cnc2c(=O)[nH]c(N)nc23)OC456 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)c2ccn3ncnc3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0080000a 81c41800 80081e00 81010f00 807829e4 0008c140 0082fc84 88083c00 16604100 81f000fa 8c00808c 4001d000 80009000 23c80100 02081484 113ed00c 01ab202c 00008000 39c1c010 0020d403 c0180128 1c000ed0 27800ac0 0c706814 10028405 c0200016 7e200202 b4050078 0003c218 00465020 d5e80800 8001c280 | 000100d2 00903a08 62184100 0db10601 100c00c0 0003e0e4 06031081 2320580e 00c60b08 c04918c0 09302204 e000b880 8c008813 00e02021 804c2440 001e020c 1842b010 0299000c 00700818 0022660d e0001900 7c288eb0 23900802 d370005c 42000c00 e4010006 40000800 d040282c 0c200380 2046000f e0004000 00d107f0 |