On Target RT_HIV1 0.27659574/CHEMBL4108147
For the given ligand LIGAND_65, we have found in our database that, being scored 0.27659574, the most similar ligand is CHEMBL4108147. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL4108147 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(CC2CC(F)(F)C2)S(=O)(=O)c2ccc3c(c2)COCC3)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 00010010 09803200 03188100 05b10601 100801da 0003c000 04000081 2300504e 02c60b00 004918c0 09302200 e001b880 8c008812 00212031 806c2480 021e030c 18423000 0219000c 0470001a 0000660d 80011920 782c8eb0 03104000 db500058 42000c00 e4012206 40080820 d000302c 0c200781 2406080f e0004000 02c107f0 |