On Target NSP1_SARS 0.16751269/CHEMBL2441741
For the given ligand Ribavirin, we have found in our database that, being scored 0.16751269, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)C(O)C1O)n2 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |