On Target PR_HIV1 0.22352941/CHEMBL492666
For the given ligand Seed1, we have found in our database that, being scored 0.22352941, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Seed1 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C[C@@H]4CCCN(Cc2cc(=O)n1[nH]c(=N)[nH]c1n2)c3ccccc34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00004002 0120080a 60100193 08050f00 20820004 00106044 01800000 28203c01 07100b00 080c08e0 08314004 4001c800 04008006 00700000 00020460 080c000e 00848808 03808002 88400008 00220201 c0100100 1c018050 20810842 40540114 20006c00 c0008601 60220020 90161880 0008c105 04460002 e0008080 200006a1 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |