On Target NP_HCoV-OC43 0.078431375/CHEMBL3233481
For the given ligand 2, we have found in our database that, being scored 0.078431375, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C=CCS(=O)CC([NH3+])C(=O)[O-] | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 44000000 20020020 00100400 01000000 00000000 00000000 00000400 00000000 00044000 00000000 40003000 00018000 00040000 80000000 00080008 04000000 00000000 00004000 00600000 40000000 00000a04 03000600 000c0010 00000200 00000000 00000000 00000010 00001000 00040120 04000000 03010020 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |