On Target NS5B_HCV1B 0.14361702/CHEMBL3645203
For the given ligand 2 Coumarinate, we have found in our database that, being scored 0.14361702, the most similar ligand is CHEMBL3645203. Check out the elaboration below.
| 2 Coumarinate (Given Ligand) | CHEMBL3645203 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccccc1O | CNC(=O)c1c2cc(C3CC3)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00200000 00000000 82000080 00000400 01800000 00000840 00000000 40008000 04008002 00000000 00000002 00082008 00000400 02000000 10018018 00020000 00000000 08000a00 00000000 00400000 00001000 80000000 00402000 40000000 00400000 00020000 04000000 00000002 | 00004006 0080de08 20080902 40310e00 010c0000 00004002 02040000 02001408 00100900 000908c0 09312024 40118800 80008c33 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0000101 1c838e38 2080c800 8360001c 00104080 c0000040 00270080 8000108c 0c408104 0046004b c4048088 a81147e0 |