On Target NP_HCoV-OC43 0.25342464/CHEMBL3233481
For the given ligand ICV333, we have found in our database that, being scored 0.25342464, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV333 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cccc(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)c4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 100a4002 01800000 40100300 00110600 24000020 08002000 80000080 22001408 10a00880 001808d2 08382004 50039000 04028802 00300000 00000442 00000002 00044600 02000000 08000000 00000201 c0100100 18208600 2000e020 81500018 01040000 c0000001 00406000 d0000080 04408100 00060003 24040000 00812600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |