On Target NA_INFB 0.36702126/CHEMBL113191
For the given ligand ICV346, we have found in our database that, being scored 0.36702126, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |