On Target PLP_SARS 0.38666666/CHEMBL358279
For the given ligand ICV804, we have found in our database that, being scored 0.38666666, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |