On Target PLP_SARS 0.336/CHEMBL358279
For the given ligand ICV802, we have found in our database that, being scored 0.336, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV802 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00020000 01001000 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000808c0 08200000 50039000 04008802 00000000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 18048608 00000000 00500018 00000000 c0000000 00000000 90000000 00000100 00060003 20040000 00802600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |