On Target NP_HCoV-OC43 0.26618704/CHEMBL3233481
For the given ligand ICV806, we have found in our database that, being scored 0.26618704, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV806 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10020006 01802000 00100100 06010e00 04000100 08000010 00000004 22003009 08a00000 000a68d0 08280004 70039000 0401a802 08103000 00000460 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000001 00000000 90000081 08408100 00068003 20040000 00804600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |