On Target NP_HCoV-OC43 0.2936508/CHEMBL3233481
For the given ligand ICV804, we have found in our database that, being scored 0.2936508, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |