On Target NP_HCoV-OC43 0.20792079/CHEMBL3233481
For the given ligand ICV802, we have found in our database that, being scored 0.20792079, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV802 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00020000 01001000 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000808c0 08200000 50039000 04008802 00000000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 18048608 00000000 00500018 00000000 c0000000 00000000 90000000 00000100 00060003 20040000 00802600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |