On Target NA_INFB 0.3387978/CHEMBL4161935
For the given ligand ICV805, we have found in our database that, being scored 0.3387978, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| ICV805 (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cc(F)cc(NC(=O)CN(C)C)c3)CC4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10024002 01800000 40100120 02010600 04000100 08000010 00000000 22001000 04a00000 00086ad0 08280004 7003b000 04018802 00103000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000001 00000000 90000081 08408100 00068003 20044000 00800600 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |