On Target NA_INFB 0.3409091/CHEMBL113191
For the given ligand ICV802, we have found in our database that, being scored 0.3409091, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| ICV802 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00020000 01001000 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000808c0 08200000 50039000 04008802 00000000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 18048608 00000000 00500018 00000000 c0000000 00000000 90000000 00000100 00060003 20040000 00802600 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |